C19H18FNOS — CID 15099529
[4-(4-fluorophenyl)-2-propan-2-yl-6-thiophen-2-yl-3-pyridinyl]methanol (PubChem CID 15099529) has the molecular formula C19H18FNOS and a molecular weight of 327.42 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-propan-2-yl-6-thiophen-2-yl-3-pyridinyl]methanol.
| Compound Name | [4-(4-fluorophenyl)-2-propan-2-yl-6-thiophen-2-yl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 15099529 |
| Molecular Formula | C19H18FNOS |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [4-(4-fluorophenyl)-2-propan-2-yl-6-thiophen-2-yl-3-pyridinyl]methanol |
| SMILES | CC(C)c1nc(-c2cccs2)cc(-c2ccc(F)cc2)c1CO |
| InChI | InChI=1S/C19H18FNOS/c1-12(2)19-16(11-22)15(13-5-7-14(20)8-6-13)10-17(21-19)18-4-3-9-23-18/h3-10,12,22H,11H2,1-2H3 |
| InChIKey | PXVZNOHNQPGXCO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |