C12H18N4O2 — CID 150996483
2-[[5-(methoxymethyl)-1H-pyrazol-3-yl]methyl]-N-methyl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 150996483) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-[[5-(methoxymethyl)-1H-pyrazol-3-yl]methyl]-N-methyl-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | 2-[[5-(methoxymethyl)-1H-pyrazol-3-yl]methyl]-N-methyl-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 150996483 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[[5-(methoxymethyl)-1H-pyrazol-3-yl]methyl]-N-methyl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CNC(=O)N1CC=CC1Cc1cc(COC)[nH]n1 |
| InChI | InChI=1S/C12H18N4O2/c1-13-12(17)16-5-3-4-11(16)7-9-6-10(8-18-2)15-14-9/h3-4,6,11H,5,7-8H2,1-2H3,(H,13,17)(H,14,15) |
| InChIKey | LTEYUPVTITZLHX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|