C7H14ClN3O — CID 156589610
1-[5-(methoxymethyl)-1H-pyrazol-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 156589610) has the molecular formula C7H14ClN3O and a molecular weight of 191.66 g/mol. Its IUPAC name is 1-[5-(methoxymethyl)-1H-pyrazol-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[5-(methoxymethyl)-1H-pyrazol-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 156589610 |
| Molecular Formula | C7H14ClN3O |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1-[5-(methoxymethyl)-1H-pyrazol-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCc1cc(COC)[nH]n1.Cl |
| InChI | InChI=1S/C7H13N3O.ClH/c1-8-4-6-3-7(5-11-2)10-9-6;/h3,8H,4-5H2,1-2H3,(H,9,10);1H |
| InChIKey | POTSBFGYHZXFOU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |