C18H26O5 — CID 151005646
1-(3,6-dioxonon-8-enoxy)non-8-ene-3,6-dione (PubChem CID 151005646) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-(3,6-dioxonon-8-enoxy)non-8-ene-3,6-dione.
| Compound Name | 1-(3,6-dioxonon-8-enoxy)non-8-ene-3,6-dione |
|---|---|
| PubChem CID | 151005646 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-(3,6-dioxonon-8-enoxy)non-8-ene-3,6-dione |
| SMILES | C=CCC(=O)CCC(=O)CCOCCC(=O)CCC(=O)CC=C |
| InChI | InChI=1S/C18H26O5/c1-3-5-15(19)7-9-17(21)11-13-23-14-12-18(22)10-8-16(20)6-4-2/h3-4H,1-2,5-14H2 |
| InChIKey | LVAKQTVWTNAPDP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|