C20H29NO7 — CID 175154958
3,6,9,12,15-pentaoxooctadec-17-enyl 2-aminoacetate (PubChem CID 175154958) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is 3,6,9,12,15-pentaoxooctadec-17-enyl 2-aminoacetate.
| Compound Name | 3,6,9,12,15-pentaoxooctadec-17-enyl 2-aminoacetate |
|---|---|
| PubChem CID | 175154958 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3,6,9,12,15-pentaoxooctadec-17-enyl 2-aminoacetate |
| SMILES | C=CCC(=O)CCC(=O)CCC(=O)CCC(=O)CCC(=O)CCOC(=O)CN |
| InChI | InChI=1S/C20H29NO7/c1-2-3-15(22)4-5-16(23)6-7-17(24)8-9-18(25)10-11-19(26)12-13-28-20(27)14-21/h2H,1,3-14,21H2 |
| InChIKey | MIOMCKDWZFQDGH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|