C26H33FN2O2 — CID 151020547
4-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-1,8-diazaspiro[4.5]dec-3-en-8-yl]methyl]-2-propan-2-yloxyphenol (PubChem CID 151020547) has the molecular formula C26H33FN2O2 and a molecular weight of 424.56 g/mol. Its IUPAC name is 4-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-1,8-diazaspiro[4.5]dec-3-en-8-yl]methyl]-2-propan-2-yloxyphenol.
| Compound Name | 4-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-1,8-diazaspiro[4.5]dec-3-en-8-yl]methyl]-2-propan-2-yloxyphenol |
|---|---|
| PubChem CID | 151020547 |
| Molecular Formula | C26H33FN2O2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 4-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-1,8-diazaspiro[4.5]dec-3-en-8-yl]methyl]-2-propan-2-yloxyphenol |
| SMILES | CC1=C[C@]2(CCN(Cc3ccc(O)c(OC(C)C)c3)[C@@H](C)C2)N(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C26H33FN2O2/c1-18(2)31-25-12-21(8-9-24(25)30)17-28-11-10-26(15-20(28)4)14-19(3)16-29(26)23-7-5-6-22(27)13-23/h5-9,12-14,18,20,30H,10-11,15-17H2,1-4H3/t20-,26-/m0/s1 |
| InChIKey | LXZBPSDYLKBXBQ-FNZWTVRRSA-N |
| XLogP | 5.51 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|