C26H31FN4O5S — CID 66930807
4-[[(5R,7S)-1-(3-fluorophenyl)-7-methyl-3-(1,2-oxazol-4-yl)-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-2-propan-2-yloxyphenol (PubChem CID 66930807) has the molecular formula C26H31FN4O5S and a molecular weight of 530.62 g/mol. Its IUPAC name is 4-[[(5R,7S)-1-(3-fluorophenyl)-7-methyl-3-(1,2-oxazol-4-yl)-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-2-propan-2-yloxyphenol.
| Compound Name | 4-[[(5R,7S)-1-(3-fluorophenyl)-7-methyl-3-(1,2-oxazol-4-yl)-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-2-propan-2-yloxyphenol |
|---|---|
| PubChem CID | 66930807 |
| Molecular Formula | C26H31FN4O5S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 4-[[(5R,7S)-1-(3-fluorophenyl)-7-methyl-3-(1,2-oxazol-4-yl)-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-2-propan-2-yloxyphenol |
| SMILES | CC(C)Oc1cc(CN2CC[C@@]3(C[C@@H]2C)CN(c2cnoc2)S(=O)(=O)N3c2cccc(F)c2)ccc1O |
| InChI | InChI=1S/C26H31FN4O5S/c1-18(2)36-25-11-20(7-8-24(25)32)15-29-10-9-26(13-19(29)3)17-30(23-14-28-35-16-23)37(33,34)31(26)22-6-4-5-21(27)12-22/h4-8,11-12,14,16,18-19,32H,9-10,13,15,17H2,1-3H3/t19-,26+/m0/s1 |
| InChIKey | XPPOIAXKZPNLCP-AFMDSPMNSA-N |
| XLogP | 4.30 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |