C21H24F4N4O4S — CID 66930529
6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethoxy)pyridin-3-ol (PubChem CID 66930529) has the molecular formula C21H24F4N4O4S and a molecular weight of 504.51 g/mol. Its IUPAC name is 6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 66930529 |
| Molecular Formula | C21H24F4N4O4S |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-4-(trifluoromethoxy)pyridin-3-ol |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1cc(OC(F)(F)F)c(O)cn1)CN(C)S(=O)(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C21H24F4N4O4S/c1-14-10-20(13-27(2)34(31,32)29(20)17-5-3-4-15(22)8-17)6-7-28(14)12-16-9-19(18(30)11-26-16)33-21(23,24)25/h3-5,8-9,11,14,30H,6-7,10,12-13H2,1-2H3/t14-,20+/m0/s1 |
| InChIKey | ZBNTXBXNKAIFDM-VBKZILBWSA-N |
| XLogP | 3.24 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |