C25H31FN4O3S — CID 66930647
(5R,7S)-8-[(5-ethoxy-1H-indol-3-yl)methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide (PubChem CID 66930647) has the molecular formula C25H31FN4O3S and a molecular weight of 486.61 g/mol. Its IUPAC name is (5R,7S)-8-[(5-ethoxy-1H-indol-3-yl)methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide.
| Compound Name | (5R,7S)-8-[(5-ethoxy-1H-indol-3-yl)methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
|---|---|
| PubChem CID | 66930647 |
| Molecular Formula | C25H31FN4O3S |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (5R,7S)-8-[(5-ethoxy-1H-indol-3-yl)methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
| SMILES | CCOc1ccc2[nH]cc(CN3CC[C@@]4(C[C@@H]3C)CN(C)S(=O)(=O)N4c3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C25H31FN4O3S/c1-4-33-22-8-9-24-23(13-22)19(15-27-24)16-29-11-10-25(14-18(29)2)17-28(3)34(31,32)30(25)21-7-5-6-20(26)12-21/h5-9,12-13,15,18,27H,4,10-11,14,16-17H2,1-3H3/t18-,25+/m0/s1 |
| InChIKey | AGOWWCHWYGWUQH-AVRWGWEMSA-N |
| XLogP | 4.13 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |