C23H27FN4O2S — CID 66930652
(5R,7S)-1-(3-fluorophenyl)-8-(1H-indol-3-ylmethyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide (PubChem CID 66930652) has the molecular formula C23H27FN4O2S and a molecular weight of 442.56 g/mol. Its IUPAC name is (5R,7S)-1-(3-fluorophenyl)-8-(1H-indol-3-ylmethyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide.
| Compound Name | (5R,7S)-1-(3-fluorophenyl)-8-(1H-indol-3-ylmethyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
|---|---|
| PubChem CID | 66930652 |
| Molecular Formula | C23H27FN4O2S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (5R,7S)-1-(3-fluorophenyl)-8-(1H-indol-3-ylmethyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1c[nH]c3ccccc13)CN(C)S(=O)(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C23H27FN4O2S/c1-17-13-23(10-11-27(17)15-18-14-25-22-9-4-3-8-21(18)22)16-26(2)31(29,30)28(23)20-7-5-6-19(24)12-20/h3-9,12,14,17,25H,10-11,13,15-16H2,1-2H3/t17-,23+/m0/s1 |
| InChIKey | VERAFTZBYHYLCH-GAJHUEQPSA-N |
| XLogP | 3.73 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |