C24H31FN4O3S — CID 66930659
4-cyclobutyl-6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol (PubChem CID 66930659) has the molecular formula C24H31FN4O3S and a molecular weight of 474.60 g/mol. Its IUPAC name is 4-cyclobutyl-6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol.
| Compound Name | 4-cyclobutyl-6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 66930659 |
| Molecular Formula | C24H31FN4O3S |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 4-cyclobutyl-6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1cc(C3CCC3)c(O)cn1)CN(C)S(=O)(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C24H31FN4O3S/c1-17-13-24(16-27(2)33(31,32)29(24)21-8-4-7-19(25)11-21)9-10-28(17)15-20-12-22(18-5-3-6-18)23(30)14-26-20/h4,7-8,11-12,14,17-18,30H,3,5-6,9-10,13,15-16H2,1-2H3/t17-,24+/m0/s1 |
| InChIKey | UOPSODCIKVTPAQ-BXKMTCNYSA-N |
| XLogP | 3.61 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |