C28H31F2N3O3S — CID 44515052
2-(4-fluoro-2-methylphenyl)-4-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]phenol (PubChem CID 44515052) has the molecular formula C28H31F2N3O3S and a molecular weight of 527.64 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-4-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]phenol.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-4-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]phenol |
|---|---|
| PubChem CID | 44515052 |
| Molecular Formula | C28H31F2N3O3S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-4-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]phenol |
| SMILES | Cc1cc(F)ccc1-c1cc(CN2CC[C@@]3(C[C@@H]2C)CN(C)S(=O)(=O)N3c2cccc(F)c2)ccc1O |
| InChI | InChI=1S/C28H31F2N3O3S/c1-19-13-23(30)8-9-25(19)26-14-21(7-10-27(26)34)17-32-12-11-28(16-20(32)2)18-31(3)37(35,36)33(28)24-6-4-5-22(29)15-24/h4-10,13-15,20,34H,11-12,16-18H2,1-3H3/t20-,28+/m0/s1 |
| InChIKey | RGTZYHRNQTXIMS-WTYVLRPYSA-N |
| XLogP | 5.07 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |