C24H26ClFN4O3S2 — CID 66930501
4-(5-chlorothiophen-2-yl)-6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol (PubChem CID 66930501) has the molecular formula C24H26ClFN4O3S2 and a molecular weight of 537.08 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol.
| Compound Name | 4-(5-chlorothiophen-2-yl)-6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 66930501 |
| Molecular Formula | C24H26ClFN4O3S2 |
| Molecular Weight | 537.08 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-6-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2,2-dioxo-2λ6-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1cc(-c3ccc(Cl)s3)c(O)cn1)CN(C)S(=O)(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C24H26ClFN4O3S2/c1-16-12-24(15-28(2)35(32,33)30(24)19-5-3-4-17(26)10-19)8-9-29(16)14-18-11-20(21(31)13-27-18)22-6-7-23(25)34-22/h3-7,10-11,13,16,31H,8-9,12,14-15H2,1-2H3/t16-,24+/m0/s1 |
| InChIKey | OFLZAVKYXKUOTN-UPCLLVRISA-N |
| XLogP | 4.73 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.08 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |