C24H33FN4O3S — CID 66930728
(5R,7S)-8-[[5-(cyclopentylmethyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide (PubChem CID 66930728) has the molecular formula C24H33FN4O3S and a molecular weight of 476.62 g/mol. Its IUPAC name is (5R,7S)-8-[[5-(cyclopentylmethyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide.
| Compound Name | (5R,7S)-8-[[5-(cyclopentylmethyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
|---|---|
| PubChem CID | 66930728 |
| Molecular Formula | C24H33FN4O3S |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (5R,7S)-8-[[5-(cyclopentylmethyl)-1,3-oxazol-4-yl]methyl]-1-(3-fluorophenyl)-3,7-dimethyl-2λ6-thia-1,3,8-triazaspiro[4.5]decane 2,2-dioxide |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1ncoc1CC1CCCC1)CN(C)S(=O)(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C24H33FN4O3S/c1-18-14-24(16-27(2)33(30,31)29(24)21-9-5-8-20(25)13-21)10-11-28(18)15-22-23(32-17-26-22)12-19-6-3-4-7-19/h5,8-9,13,17-19H,3-4,6-7,10-12,14-16H2,1-2H3/t18-,24+/m0/s1 |
| InChIKey | XIUIAXXHGAUWDE-MHECFPHRSA-N |
| XLogP | 3.97 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |