C23H31FN4OS — CID 123311337
4-(cyclobutylmethyl)-5-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-1,3-oxazole (PubChem CID 123311337) has the molecular formula C23H31FN4OS and a molecular weight of 430.59 g/mol. Its IUPAC name is 4-(cyclobutylmethyl)-5-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-1,3-oxazole.
| Compound Name | 4-(cyclobutylmethyl)-5-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 123311337 |
| Molecular Formula | C23H31FN4OS |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 4-(cyclobutylmethyl)-5-[[(5R,7S)-1-(3-fluorophenyl)-3,7-dimethyl-2-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-1,3-oxazole |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1ocnc1CC1CCC1)CN(C)SN2c1cccc(F)c1 |
| InChI | InChI=1S/C23H31FN4OS/c1-17-13-23(15-26(2)30-28(23)20-8-4-7-19(24)12-20)9-10-27(17)14-22-21(25-16-29-22)11-18-5-3-6-18/h4,7-8,12,16-18H,3,5-6,9-11,13-15H2,1-2H3/t17-,23+/m0/s1 |
| InChIKey | RCGJZYIKNXRGSC-GAJHUEQPSA-N |
| XLogP | 4.89 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|