C26H30F2N4O3S — CID 66930511
4-(2-fluorophenyl)-6-[[(5R,7S)-1-(3-fluorophenyl)-2,2-dihydroxy-3,7-dimethyl-2λ4-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol (PubChem CID 66930511) has the molecular formula C26H30F2N4O3S and a molecular weight of 516.61 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-6-[[(5R,7S)-1-(3-fluorophenyl)-2,2-dihydroxy-3,7-dimethyl-2λ4-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol.
| Compound Name | 4-(2-fluorophenyl)-6-[[(5R,7S)-1-(3-fluorophenyl)-2,2-dihydroxy-3,7-dimethyl-2λ4-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 66930511 |
| Molecular Formula | C26H30F2N4O3S |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 4-(2-fluorophenyl)-6-[[(5R,7S)-1-(3-fluorophenyl)-2,2-dihydroxy-3,7-dimethyl-2λ4-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]pyridin-3-ol |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1cc(-c3ccccc3F)c(O)cn1)CN(C)S(O)(O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C26H30F2N4O3S/c1-18-14-26(17-30(2)36(34,35)32(26)21-7-5-6-19(27)12-21)10-11-31(18)16-20-13-23(25(33)15-29-20)22-8-3-4-9-24(22)28/h3-9,12-13,15,18,33-35H,10-11,14,16-17H2,1-2H3/t18-,26+/m0/s1 |
| InChIKey | MAFNUONNWSXLHV-HFJWLAOPSA-N |
| XLogP | 5.49 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |