C26H33FN4O5S — CID 66930804
4-[[(5R,7S)-1-(3-fluorophenyl)-2,2-dihydroxy-7-methyl-3-(1,2-oxazol-4-yl)-2λ4-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-2-propan-2-yloxyphenol (PubChem CID 66930804) has the molecular formula C26H33FN4O5S and a molecular weight of 532.64 g/mol. Its IUPAC name is 4-[[(5R,7S)-1-(3-fluorophenyl)-2,2-dihydroxy-7-methyl-3-(1,2-oxazol-4-yl)-2λ4-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-2-propan-2-yloxyphenol.
| Compound Name | 4-[[(5R,7S)-1-(3-fluorophenyl)-2,2-dihydroxy-7-methyl-3-(1,2-oxazol-4-yl)-2λ4-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-2-propan-2-yloxyphenol |
|---|---|
| PubChem CID | 66930804 |
| Molecular Formula | C26H33FN4O5S |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 4-[[(5R,7S)-1-(3-fluorophenyl)-2,2-dihydroxy-7-methyl-3-(1,2-oxazol-4-yl)-2λ4-thia-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]-2-propan-2-yloxyphenol |
| SMILES | CC(C)Oc1cc(CN2CC[C@@]3(C[C@@H]2C)CN(c2cnoc2)S(O)(O)N3c2cccc(F)c2)ccc1O |
| InChI | InChI=1S/C26H33FN4O5S/c1-18(2)36-25-11-20(7-8-24(25)32)15-29-10-9-26(13-19(29)3)17-30(23-14-28-35-16-23)37(33,34)31(26)22-6-4-5-21(27)12-22/h4-8,11-12,14,16,18-19,32-34H,9-10,13,15,17H2,1-3H3/t19-,26+/m0/s1 |
| InChIKey | DGBMJHHWNDODKQ-AFMDSPMNSA-N |
| XLogP | 5.64 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |