C6H12N2O4Se2 — CID 15104
2-amino-3-[(2-amino-2-carboxyethyl)diselanyl]propanoic acid (PubChem CID 15104) has the molecular formula C6H12N2O4Se2 and a molecular weight of 334.09 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-2-carboxyethyl)diselanyl]propanoic acid.
| Compound Name | 2-amino-3-[(2-amino-2-carboxyethyl)diselanyl]propanoic acid |
|---|---|
| PubChem CID | 15104 |
| Molecular Formula | C6H12N2O4Se2 |
| Molecular Weight | 334.09 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | 2-amino-3-[(2-amino-2-carboxyethyl)diselanyl]propanoic acid |
| SMILES | NC(C[Se][Se]CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4Se2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| InChIKey | JULROCUWKLNBSN-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.09 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|