C9H16N2O4Se2 — CID 140542965
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]hex-5-enoic acid (PubChem CID 140542965) has the molecular formula C9H16N2O4Se2 and a molecular weight of 374.16 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]hex-5-enoic acid.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 140542965 |
| Molecular Formula | C9H16N2O4Se2 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]hex-5-enoic acid |
| SMILES | C=CCC([Se][Se]C[C@H](N)C(=O)O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H16N2O4Se2/c1-2-3-6(7(11)9(14)15)17-16-4-5(10)8(12)13/h2,5-7H,1,3-4,10-11H2,(H,12,13)(H,14,15)/t5-,6?,7-/m0/s1 |
| InChIKey | GZBHOWWLTUCMKK-LOJRBXKRSA-N |
| XLogP | -1.08 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|