C15H26NO5S3+ — CID 15104238
dimethyl-[1-(4-methylphenyl)sulfonylsulfanylhexan-2-yl]-sulfoazanium (PubChem CID 15104238) has the molecular formula C15H26NO5S3+ and a molecular weight of 396.58 g/mol. Its IUPAC name is dimethyl-[1-(4-methylphenyl)sulfonylsulfanylhexan-2-yl]-sulfoazanium.
| Compound Name | dimethyl-[1-(4-methylphenyl)sulfonylsulfanylhexan-2-yl]-sulfoazanium |
|---|---|
| PubChem CID | 15104238 |
| Molecular Formula | C15H26NO5S3+ |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | dimethyl-[1-(4-methylphenyl)sulfonylsulfanylhexan-2-yl]-sulfoazanium |
| SMILES | CCCCC(CSS(=O)(=O)c1ccc(C)cc1)[N+](C)(C)S(=O)(=O)O |
| InChI | InChI=1S/C15H25NO5S3/c1-5-6-7-14(16(3,4)24(19,20)21)12-22-23(17,18)15-10-8-13(2)9-11-15/h8-11,14H,5-7,12H2,1-4H3/p+1 |
| InChIKey | NYAGICAFKRCPOT-UHFFFAOYSA-O |
| XLogP | 2.85 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|