C28H39ClN8O4S — CID 151057420
butyl 4-[3-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 151057420) has the molecular formula C28H39ClN8O4S and a molecular weight of 619.19 g/mol. Its IUPAC name is butyl 4-[3-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | butyl 4-[3-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 151057420 |
| Molecular Formula | C28H39ClN8O4S |
| Molecular Weight | 619.19 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | butyl 4-[3-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(n2ccc(Nc3ncc(C)c(Nc4ccc(Cl)c(NS(=O)(=O)C(C)(C)C)c4)n3)n2)CC1 |
| InChI | InChI=1S/C28H39ClN8O4S/c1-6-7-16-41-27(38)36-13-10-21(11-14-36)37-15-12-24(34-37)32-26-30-18-19(2)25(33-26)31-20-8-9-22(29)23(17-20)35-42(39,40)28(3,4)5/h8-9,12,15,17-18,21,35H,6-7,10-11,13-14,16H2,1-5H3,(H2,30,31,32,33,34) |
| InChIKey | MFKZHZCWPWNJJF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.19 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|