C24H26ClN5O4S — CID 162514090
(E)-3-[4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enoic acid (PubChem CID 162514090) has the molecular formula C24H26ClN5O4S and a molecular weight of 516.02 g/mol. Its IUPAC name is (E)-3-[4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162514090 |
| Molecular Formula | C24H26ClN5O4S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | (E)-3-[4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cc1cnc(Nc2ccc(/C=C/C(=O)O)cc2)nc1Nc1ccc(Cl)c(NS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C24H26ClN5O4S/c1-15-14-26-23(28-17-8-5-16(6-9-17)7-12-21(31)32)29-22(15)27-18-10-11-19(25)20(13-18)30-35(33,34)24(2,3)4/h5-14,30H,1-4H3,(H,31,32)(H2,26,27,28,29)/b12-7+ |
| InChIKey | MNPROHQXQFPKPE-KPKJPENVSA-N |
| XLogP | 5.56 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|