C28H30ClN7O3S — CID 162514091
N-(2-aminophenyl)-4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]benzamide (PubChem CID 162514091) has the molecular formula C28H30ClN7O3S and a molecular weight of 580.11 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 162514091 |
| Molecular Formula | C28H30ClN7O3S |
| Molecular Weight | 580.11 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]benzamide |
| SMILES | Cc1cnc(Nc2ccc(C(=O)Nc3ccccc3N)cc2)nc1Nc1ccc(Cl)c(NS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H30ClN7O3S/c1-17-16-31-27(33-19-11-9-18(10-12-19)26(37)34-23-8-6-5-7-22(23)30)35-25(17)32-20-13-14-21(29)24(15-20)36-40(38,39)28(2,3)4/h5-16,36H,30H2,1-4H3,(H,34,37)(H2,31,32,33,35) |
| InChIKey | FMFGBNSYDXGCMP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.11 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|