C26H30ClN5O4S — CID 162514093
ethyl (E)-3-[4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enoate (PubChem CID 162514093) has the molecular formula C26H30ClN5O4S and a molecular weight of 544.08 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162514093 |
| Molecular Formula | C26H30ClN5O4S |
| Molecular Weight | 544.08 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | ethyl (E)-3-[4-[[4-[3-(tert-butylsulfonylamino)-4-chloroanilino]-5-methylpyrimidin-2-yl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(Nc2ncc(C)c(Nc3ccc(Cl)c(NS(=O)(=O)C(C)(C)C)c3)n2)cc1 |
| InChI | InChI=1S/C26H30ClN5O4S/c1-6-36-23(33)14-9-18-7-10-19(11-8-18)30-25-28-16-17(2)24(31-25)29-20-12-13-21(27)22(15-20)32-37(34,35)26(3,4)5/h7-16,32H,6H2,1-5H3,(H2,28,29,30,31)/b14-9+ |
| InChIKey | UBJTVTVAQJEOTQ-NTEUORMPSA-N |
| XLogP | 6.04 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.08 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|