C25H32O5 — CID 15106532
2-[4-[(4-heptoxyphenyl)methoxy]-1-hydroxy-2,3-dihydro-1H-inden-2-yl]acetic acid (PubChem CID 15106532) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[4-[(4-heptoxyphenyl)methoxy]-1-hydroxy-2,3-dihydro-1H-inden-2-yl]acetic acid.
| Compound Name | 2-[4-[(4-heptoxyphenyl)methoxy]-1-hydroxy-2,3-dihydro-1H-inden-2-yl]acetic acid |
|---|---|
| PubChem CID | 15106532 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-[4-[(4-heptoxyphenyl)methoxy]-1-hydroxy-2,3-dihydro-1H-inden-2-yl]acetic acid |
| SMILES | CCCCCCCOc1ccc(COc2cccc3c2CC(CC(=O)O)C3O)cc1 |
| InChI | InChI=1S/C25H32O5/c1-2-3-4-5-6-14-29-20-12-10-18(11-13-20)17-30-23-9-7-8-21-22(23)15-19(25(21)28)16-24(26)27/h7-13,19,25,28H,2-6,14-17H2,1H3,(H,26,27) |
| InChIKey | PQGJQTNTTUVMPM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|