About 8-(bromomethyl)pyrido[2,3-d]pyridazine
8-(bromomethyl)pyrido[2,3-d]pyridazine (PubChem CID 151069690) has the molecular formula C8H6BrN3
and a molecular weight of 224.06 g/mol. Its IUPAC name is 8-(bromomethyl)pyrido[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 8-(bromomethyl)pyrido[2,3-d]pyridazine |
| PubChem CID | 151069690 |
| Molecular Formula | C8H6BrN3 |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 8-(bromomethyl)pyrido[2,3-d]pyridazine |
| SMILES | BrCc1nncc2cccnc12 |
| InChI | InChI=1S/C8H6BrN3/c9-4-7-8-6(5-11-12-7)2-1-3-10-8/h1-3,5H,4H2 |
| InChIKey | MHWMKLHZKOYUQE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-(bromomethyl)pyrido[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(bromomethyl)pyrido[2,3-d]pyridazine?
The IUPAC name of 8-(bromomethyl)pyrido[2,3-d]pyridazine (CID 151069690) is 8-(bromomethyl)pyrido[2,3-d]pyridazine.
What is the SMILES notation for 8-(bromomethyl)pyrido[2,3-d]pyridazine?
The canonical SMILES for 8-(bromomethyl)pyrido[2,3-d]pyridazine is BrCc1nncc2cccnc12.
What is the InChIKey of 8-(bromomethyl)pyrido[2,3-d]pyridazine?
The InChIKey is MHWMKLHZKOYUQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3/c9-4-7-8-6(5-11-12-7)2-1-3-10-8/h1-3,5H,4H2.
What are the key properties of 8-(bromomethyl)pyrido[2,3-d]pyridazine?
8-(bromomethyl)pyrido[2,3-d]pyridazine has a molecular weight of 224.06 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(bromomethyl)pyrido[2,3-d]pyridazine is sourced from PubChem (CID 151069690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).