C10H10F3NO — CID 151071502
2-methyl-N-(1,3,5-trifluorocyclohexa-2,4-dien-1-yl)prop-2-enamide (PubChem CID 151071502) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 2-methyl-N-(1,3,5-trifluorocyclohexa-2,4-dien-1-yl)prop-2-enamide.
| Compound Name | 2-methyl-N-(1,3,5-trifluorocyclohexa-2,4-dien-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 151071502 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-methyl-N-(1,3,5-trifluorocyclohexa-2,4-dien-1-yl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NC1(F)C=C(F)C=C(F)C1 |
| InChI | InChI=1S/C10H10F3NO/c1-6(2)9(15)14-10(13)4-7(11)3-8(12)5-10/h3-4H,1,5H2,2H3,(H,14,15) |
| InChIKey | MIFPYCSMIVMUJJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|