C14H20AsNO5 — CID 151097783
(3-acetamido-5-cyclohexyl-2-hydroxyphenyl)arsonic acid (PubChem CID 151097783) has the molecular formula C14H20AsNO5 and a molecular weight of 357.24 g/mol. Its IUPAC name is (3-acetamido-5-cyclohexyl-2-hydroxyphenyl)arsonic acid.
| Compound Name | (3-acetamido-5-cyclohexyl-2-hydroxyphenyl)arsonic acid |
|---|---|
| PubChem CID | 151097783 |
| Molecular Formula | C14H20AsNO5 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (3-acetamido-5-cyclohexyl-2-hydroxyphenyl)arsonic acid |
| SMILES | CC(=O)Nc1cc(C2CCCCC2)cc([As](=O)(O)O)c1O |
| InChI | InChI=1S/C14H20AsNO5/c1-9(17)16-13-8-11(10-5-3-2-4-6-10)7-12(14(13)18)15(19,20)21/h7-8,10,18H,2-6H2,1H3,(H,16,17)(H2,19,20,21) |
| InChIKey | MNMKEXRYNPYVOD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|