C17H15N3 — CID 15111818
2-methyl-4-phenyl-3,4-dihydropyrimido[1,2-a]benzimidazole (PubChem CID 15111818) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-methyl-4-phenyl-3,4-dihydropyrimido[1,2-a]benzimidazole.
| Compound Name | 2-methyl-4-phenyl-3,4-dihydropyrimido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 15111818 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-methyl-4-phenyl-3,4-dihydropyrimido[1,2-a]benzimidazole |
| SMILES | CC1=Nc2nc3ccccc3n2C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H15N3/c1-12-11-16(13-7-3-2-4-8-13)20-15-10-6-5-9-14(15)19-17(20)18-12/h2-10,16H,11H2,1H3 |
| InChIKey | ZNCOVYOHKQOJOD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |