C22H17N3O — CID 947025
2-[(4S)-4-phenyl-3,4-dihydropyrimido[1,2-a]benzimidazol-2-yl]phenol (PubChem CID 947025) has the molecular formula C22H17N3O and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-[(4S)-4-phenyl-3,4-dihydropyrimido[1,2-a]benzimidazol-2-yl]phenol.
| Compound Name | 2-[(4S)-4-phenyl-3,4-dihydropyrimido[1,2-a]benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 947025 |
| Molecular Formula | C22H17N3O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-[(4S)-4-phenyl-3,4-dihydropyrimido[1,2-a]benzimidazol-2-yl]phenol |
| SMILES | Oc1ccccc1C1=Nc2nc3ccccc3n2[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H17N3O/c26-21-13-7-4-10-16(21)18-14-20(15-8-2-1-3-9-15)25-19-12-6-5-11-17(19)23-22(25)24-18/h1-13,20,26H,14H2/t20-/m0/s1 |
| InChIKey | ANQWQLGUIIXYDF-FQEVSTJZSA-N |
| XLogP | 4.86 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |