C32H23Cl3N4O8 — CID 15115670
[(2R,3R,4S,5R)-3,4-bis[(4-chlorobenzoyl)oxy]-5-(6-methoxypurin-9-yl)oxolan-2-yl]methyl 4-chlorobenzoate (PubChem CID 15115670) has the molecular formula C32H23Cl3N4O8 and a molecular weight of 697.92 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-bis[(4-chlorobenzoyl)oxy]-5-(6-methoxypurin-9-yl)oxolan-2-yl]methyl 4-chlorobenzoate.
| Compound Name | [(2R,3R,4S,5R)-3,4-bis[(4-chlorobenzoyl)oxy]-5-(6-methoxypurin-9-yl)oxolan-2-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 15115670 |
| Molecular Formula | C32H23Cl3N4O8 |
| Molecular Weight | 697.92 g/mol |
| Exact Mass | 696.06 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-bis[(4-chlorobenzoyl)oxy]-5-(6-methoxypurin-9-yl)oxolan-2-yl]methyl 4-chlorobenzoate |
| SMILES | COc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccc(Cl)cc2)[C@@H](OC(=O)c2ccc(Cl)cc2)[C@@H]1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H23Cl3N4O8/c1-43-28-24-27(36-15-37-28)39(16-38-24)29-26(47-32(42)19-6-12-22(35)13-7-19)25(46-31(41)18-4-10-21(34)11-5-18)23(45-29)14-44-30(40)17-2-8-20(33)9-3-17/h2-13,15-16,23,25-26,29H,14H2,1H3/t23-,25-,26+,29-/m1/s1 |
| InChIKey | UURJQJNBCUOXJZ-JAVQUFKRSA-N |
| XLogP | 6.00 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.92 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|