C16H19N3O — CID 151170288
5-(2-prop-2-ynylpiperazin-1-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 151170288) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 5-(2-prop-2-ynylpiperazin-1-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-(2-prop-2-ynylpiperazin-1-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 151170288 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 5-(2-prop-2-ynylpiperazin-1-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C#CCC1CNCCN1c1cccc2c1CCC(=O)N2 |
| InChI | InChI=1S/C16H19N3O/c1-2-4-12-11-17-9-10-19(12)15-6-3-5-14-13(15)7-8-16(20)18-14/h1,3,5-6,12,17H,4,7-11H2,(H,18,20) |
| InChIKey | NCDAUYGEFMNLKM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|