C28H31N3O10S — CID 15117529
5-O-tert-butyl 1-O-[(4-nitrophenyl)methyl] 2-oxo-3-[[(2R,3R)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl]sulfanylmethyl]pentanedioate (PubChem CID 15117529) has the molecular formula C28H31N3O10S and a molecular weight of 601.63 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-[(4-nitrophenyl)methyl] 2-oxo-3-[[(2R,3R)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl]sulfanylmethyl]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-[(4-nitrophenyl)methyl] 2-oxo-3-[[(2R,3R)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl]sulfanylmethyl]pentanedioate |
|---|---|
| PubChem CID | 15117529 |
| Molecular Formula | C28H31N3O10S |
| Molecular Weight | 601.63 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | 5-O-tert-butyl 1-O-[(4-nitrophenyl)methyl] 2-oxo-3-[[(2R,3R)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl]sulfanylmethyl]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC(CS[C@H]1NC(=O)[C@H]1NC(=O)COc1ccccc1)C(=O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H31N3O10S/c1-28(2,3)41-22(33)13-18(24(34)27(36)40-14-17-9-11-19(12-10-17)31(37)38)16-42-26-23(25(35)30-26)29-21(32)15-39-20-7-5-4-6-8-20/h4-12,18,23,26H,13-16H2,1-3H3,(H,29,32)(H,30,35)/t18?,23-,26-/m1/s1 |
| InChIKey | GPSYDDQWJSFLDC-TWGVZLPFSA-N |
| XLogP | 2.31 |
| TPSA | 180.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|