C15H12ClNO2S — CID 151180271
10-(2-chloroacetyl)-1-methyl-5H-thieno[3,4-b][1]benzazepin-4-one (PubChem CID 151180271) has the molecular formula C15H12ClNO2S and a molecular weight of 305.79 g/mol. Its IUPAC name is 10-(2-chloroacetyl)-1-methyl-5H-thieno[3,4-b][1]benzazepin-4-one.
| Compound Name | 10-(2-chloroacetyl)-1-methyl-5H-thieno[3,4-b][1]benzazepin-4-one |
|---|---|
| PubChem CID | 151180271 |
| Molecular Formula | C15H12ClNO2S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 10-(2-chloroacetyl)-1-methyl-5H-thieno[3,4-b][1]benzazepin-4-one |
| SMILES | Cc1scc2c1N(C(=O)CCl)c1ccccc1CC2=O |
| InChI | InChI=1S/C15H12ClNO2S/c1-9-15-11(8-20-9)13(18)6-10-4-2-3-5-12(10)17(15)14(19)7-16/h2-5,8H,6-7H2,1H3 |
| InChIKey | NEDKEUNYDNNQJE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|