C29H34ClN3O4S — CID 151182747
[1'-benzyl-8-(6-chloronaphthalen-2-yl)sulfonylspiro[4,6,7,9-tetrahydro-2H-pyrazino[2,1-b][1,3]oxazine-3,4'-piperidine]-9a-yl]methanol (PubChem CID 151182747) has the molecular formula C29H34ClN3O4S and a molecular weight of 556.13 g/mol. Its IUPAC name is [1'-benzyl-8-(6-chloronaphthalen-2-yl)sulfonylspiro[4,6,7,9-tetrahydro-2H-pyrazino[2,1-b][1,3]oxazine-3,4'-piperidine]-9a-yl]methanol.
| Compound Name | [1'-benzyl-8-(6-chloronaphthalen-2-yl)sulfonylspiro[4,6,7,9-tetrahydro-2H-pyrazino[2,1-b][1,3]oxazine-3,4'-piperidine]-9a-yl]methanol |
|---|---|
| PubChem CID | 151182747 |
| Molecular Formula | C29H34ClN3O4S |
| Molecular Weight | 556.13 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | [1'-benzyl-8-(6-chloronaphthalen-2-yl)sulfonylspiro[4,6,7,9-tetrahydro-2H-pyrazino[2,1-b][1,3]oxazine-3,4'-piperidine]-9a-yl]methanol |
| SMILES | O=S(=O)(c1ccc2cc(Cl)ccc2c1)N1CCN2CC3(CCN(Cc4ccccc4)CC3)COC2(CO)C1 |
| InChI | InChI=1S/C29H34ClN3O4S/c30-26-8-6-25-17-27(9-7-24(25)16-26)38(35,36)33-15-14-32-19-28(22-37-29(32,20-33)21-34)10-12-31(13-11-28)18-23-4-2-1-3-5-23/h1-9,16-17,34H,10-15,18-22H2 |
| InChIKey | NEQLLYNUHCTWMT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |