C29H33ClN4O4S — CID 69077981
1'-benzyl-7-(6-chloronaphthalen-2-yl)sulfonyl-8a-(methoxymethyl)spiro[1,3,6,8-tetrahydroimidazo[1,2-a]pyrazine-2,4'-piperidine]-5-one (PubChem CID 69077981) has the molecular formula C29H33ClN4O4S and a molecular weight of 569.13 g/mol. Its IUPAC name is 1'-benzyl-7-(6-chloronaphthalen-2-yl)sulfonyl-8a-(methoxymethyl)spiro[1,3,6,8-tetrahydroimidazo[1,2-a]pyrazine-2,4'-piperidine]-5-one.
| Compound Name | 1'-benzyl-7-(6-chloronaphthalen-2-yl)sulfonyl-8a-(methoxymethyl)spiro[1,3,6,8-tetrahydroimidazo[1,2-a]pyrazine-2,4'-piperidine]-5-one |
|---|---|
| PubChem CID | 69077981 |
| Molecular Formula | C29H33ClN4O4S |
| Molecular Weight | 569.13 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 1'-benzyl-7-(6-chloronaphthalen-2-yl)sulfonyl-8a-(methoxymethyl)spiro[1,3,6,8-tetrahydroimidazo[1,2-a]pyrazine-2,4'-piperidine]-5-one |
| SMILES | COCC12CN(S(=O)(=O)c3ccc4cc(Cl)ccc4c3)CC(=O)N1CC1(CCN(Cc3ccccc3)CC1)N2 |
| InChI | InChI=1S/C29H33ClN4O4S/c1-38-21-29-20-33(39(36,37)26-10-8-23-15-25(30)9-7-24(23)16-26)18-27(35)34(29)19-28(31-29)11-13-32(14-12-28)17-22-5-3-2-4-6-22/h2-10,15-16,31H,11-14,17-21H2,1H3 |
| InChIKey | GLLOCBDQAVIHPK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.13 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |