C26H32N6O7S — CID 69049066
1'-benzyl-8a-[[methyl-(2-nitrophenyl)sulfonylamino]methyl]-5-oxospiro[1,3,6,8-tetrahydroimidazo[1,2-a]pyrazine-2,4'-piperidine]-7-carboxylic acid (PubChem CID 69049066) has the molecular formula C26H32N6O7S and a molecular weight of 572.64 g/mol. Its IUPAC name is 1'-benzyl-8a-[[methyl-(2-nitrophenyl)sulfonylamino]methyl]-5-oxospiro[1,3,6,8-tetrahydroimidazo[1,2-a]pyrazine-2,4'-piperidine]-7-carboxylic acid.
| Compound Name | 1'-benzyl-8a-[[methyl-(2-nitrophenyl)sulfonylamino]methyl]-5-oxospiro[1,3,6,8-tetrahydroimidazo[1,2-a]pyrazine-2,4'-piperidine]-7-carboxylic acid |
|---|---|
| PubChem CID | 69049066 |
| Molecular Formula | C26H32N6O7S |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 1'-benzyl-8a-[[methyl-(2-nitrophenyl)sulfonylamino]methyl]-5-oxospiro[1,3,6,8-tetrahydroimidazo[1,2-a]pyrazine-2,4'-piperidine]-7-carboxylic acid |
| SMILES | CN(CC12CN(C(=O)O)CC(=O)N1CC1(CCN(Cc3ccccc3)CC1)N2)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H32N6O7S/c1-28(40(38,39)22-10-6-5-9-21(22)32(36)37)18-26-19-30(24(34)35)16-23(33)31(26)17-25(27-26)11-13-29(14-12-25)15-20-7-3-2-4-8-20/h2-10,27H,11-19H2,1H3,(H,34,35) |
| InChIKey | UYXLXHSPGBUWPD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 156.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|