C17H22N6O2 — CID 151192000
5-[5-(4-carbamimidoylphenoxy)pentoxy]pyrazine-2-carboximidamide (PubChem CID 151192000) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-[5-(4-carbamimidoylphenoxy)pentoxy]pyrazine-2-carboximidamide.
| Compound Name | 5-[5-(4-carbamimidoylphenoxy)pentoxy]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 151192000 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 5-[5-(4-carbamimidoylphenoxy)pentoxy]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCCOc2cnc(/C(N)=N/[H])cn2)cc1 |
| InChI | InChI=1S/C17H22N6O2/c18-16(19)12-4-6-13(7-5-12)24-8-2-1-3-9-25-15-11-22-14(10-23-15)17(20)21/h4-7,10-11H,1-3,8-9H2,(H3,18,19)(H3,20,21) |
| InChIKey | NGMZDKNVDFPJQC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 143.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|