C18H15F3N4O3 — CID 151194790
4-[4-(4-nitro-1H-benzimidazol-2-yl)-2-(trifluoromethyl)phenyl]morpholine (PubChem CID 151194790) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is 4-[4-(4-nitro-1H-benzimidazol-2-yl)-2-(trifluoromethyl)phenyl]morpholine.
| Compound Name | 4-[4-(4-nitro-1H-benzimidazol-2-yl)-2-(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 151194790 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[4-(4-nitro-1H-benzimidazol-2-yl)-2-(trifluoromethyl)phenyl]morpholine |
| SMILES | O=[N+]([O-])c1cccc2[nH]c(-c3ccc(N4CCOCC4)c(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C18H15F3N4O3/c19-18(20,21)12-10-11(4-5-14(12)24-6-8-28-9-7-24)17-22-13-2-1-3-15(25(26)27)16(13)23-17/h1-5,10H,6-9H2,(H,22,23) |
| InChIKey | NHBKKBZKQJATGM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|