C10H11N3S — CID 15121694
5-(2,4,6-trimethylphenyl)thiatriazole (PubChem CID 15121694) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 5-(2,4,6-trimethylphenyl)thiatriazole.
| Compound Name | 5-(2,4,6-trimethylphenyl)thiatriazole |
|---|---|
| PubChem CID | 15121694 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-(2,4,6-trimethylphenyl)thiatriazole |
| SMILES | Cc1cc(C)c(-c2nnns2)c(C)c1 |
| InChI | InChI=1S/C10H11N3S/c1-6-4-7(2)9(8(3)5-6)10-11-12-13-14-10/h4-5H,1-3H3 |
| InChIKey | IJKAKJCFIWPCOK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |