C12H8F6N2 — CID 15122026
5-phenyl-3,6-bis(trifluoromethyl)-1,4-dihydropyridazine (PubChem CID 15122026) has the molecular formula C12H8F6N2 and a molecular weight of 294.20 g/mol. Its IUPAC name is 5-phenyl-3,6-bis(trifluoromethyl)-1,4-dihydropyridazine.
| Compound Name | 5-phenyl-3,6-bis(trifluoromethyl)-1,4-dihydropyridazine |
|---|---|
| PubChem CID | 15122026 |
| Molecular Formula | C12H8F6N2 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-phenyl-3,6-bis(trifluoromethyl)-1,4-dihydropyridazine |
| SMILES | FC(F)(F)C1=NNC(C(F)(F)F)=C(c2ccccc2)C1 |
| InChI | InChI=1S/C12H8F6N2/c13-11(14,15)9-6-8(7-4-2-1-3-5-7)10(20-19-9)12(16,17)18/h1-5,20H,6H2 |
| InChIKey | AIMYDRYTYRPPOX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |