C25H21ClN2O4S — CID 151231441
pyridin-4-ylmethylsulfanyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 151231441) has the molecular formula C25H21ClN2O4S and a molecular weight of 480.97 g/mol. Its IUPAC name is pyridin-4-ylmethylsulfanyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | pyridin-4-ylmethylsulfanyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 151231441 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | pyridin-4-ylmethylsulfanyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)OSCc1ccncc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClN2O4S/c1-16-21(14-24(29)32-33-15-17-9-11-27-12-10-17)22-13-20(31-2)7-8-23(22)28(16)25(30)18-3-5-19(26)6-4-18/h3-13H,14-15H2,1-2H3 |
| InChIKey | NOJIKDJYTBLKSE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|