C13H26N2O4 — CID 151236893
N',N'-diethoxy-2,2-di(propan-2-yl)propanediamide (PubChem CID 151236893) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is N',N'-diethoxy-2,2-di(propan-2-yl)propanediamide.
| Compound Name | N',N'-diethoxy-2,2-di(propan-2-yl)propanediamide |
|---|---|
| PubChem CID | 151236893 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N',N'-diethoxy-2,2-di(propan-2-yl)propanediamide |
| SMILES | CCON(OCC)C(=O)C(C(N)=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C13H26N2O4/c1-7-18-15(19-8-2)12(17)13(9(3)4,10(5)6)11(14)16/h9-10H,7-8H2,1-6H3,(H2,14,16) |
| InChIKey | NPLSMWCBIXXYJD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|