C25H30N2O — CID 151278465
1-benzyl-N,N-dimethyl-6-(4-morpholin-4-ylphenyl)cyclohexa-2,4-dien-1-amine (PubChem CID 151278465) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-benzyl-N,N-dimethyl-6-(4-morpholin-4-ylphenyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1-benzyl-N,N-dimethyl-6-(4-morpholin-4-ylphenyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 151278465 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-benzyl-N,N-dimethyl-6-(4-morpholin-4-ylphenyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CN(C)C1(Cc2ccccc2)C=CC=CC1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H30N2O/c1-26(2)25(20-21-8-4-3-5-9-21)15-7-6-10-24(25)22-11-13-23(14-12-22)27-16-18-28-19-17-27/h3-15,24H,16-20H2,1-2H3 |
| InChIKey | NXWDGRRVDPIQMB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|