C17H20O3 — CID 15128490
methyl 6,6-dimethyl-8,9,10,10a-tetrahydrobenzo[c]chromene-10-carboxylate (PubChem CID 15128490) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl 6,6-dimethyl-8,9,10,10a-tetrahydrobenzo[c]chromene-10-carboxylate.
| Compound Name | methyl 6,6-dimethyl-8,9,10,10a-tetrahydrobenzo[c]chromene-10-carboxylate |
|---|---|
| PubChem CID | 15128490 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | methyl 6,6-dimethyl-8,9,10,10a-tetrahydrobenzo[c]chromene-10-carboxylate |
| SMILES | COC(=O)C1CCC=C2C1c1ccccc1OC2(C)C |
| InChI | InChI=1S/C17H20O3/c1-17(2)13-9-6-8-12(16(18)19-3)15(13)11-7-4-5-10-14(11)20-17/h4-5,7,9-10,12,15H,6,8H2,1-3H3 |
| InChIKey | JAYWDEKEVRGOQI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|