C21H26N4O2S — CID 151289843
N-(5-methyl-1,3-thiazol-2-yl)-2-[1-[4-(prop-2-enoylamino)phenyl]piperidin-3-yl]propanamide (PubChem CID 151289843) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-2-[1-[4-(prop-2-enoylamino)phenyl]piperidin-3-yl]propanamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-2-[1-[4-(prop-2-enoylamino)phenyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 151289843 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-2-[1-[4-(prop-2-enoylamino)phenyl]piperidin-3-yl]propanamide |
| SMILES | C=CC(=O)Nc1ccc(N2CCCC(C(C)C(=O)Nc3ncc(C)s3)C2)cc1 |
| InChI | InChI=1S/C21H26N4O2S/c1-4-19(26)23-17-7-9-18(10-8-17)25-11-5-6-16(13-25)15(3)20(27)24-21-22-12-14(2)28-21/h4,7-10,12,15-16H,1,5-6,11,13H2,2-3H3,(H,23,26)(H,22,24,27) |
| InChIKey | OAEVQHXQODXCTN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|