C8H10F3N3O4S — CID 15130033
2-(trifluoromethylsulfonyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 15130033) has the molecular formula C8H10F3N3O4S and a molecular weight of 301.25 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2-(trifluoromethylsulfonyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 15130033 |
| Molecular Formula | C8H10F3N3O4S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-(trifluoromethylsulfonyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1NCC(=O)N2CCN(S(=O)(=O)C(F)(F)F)CC12 |
| InChI | InChI=1S/C8H10F3N3O4S/c9-8(10,11)19(17,18)13-1-2-14-5(4-13)7(16)12-3-6(14)15/h5H,1-4H2,(H,12,16) |
| InChIKey | XJNJYBAGTMQUGO-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |