C15H19N3O6S — CID 50949239
2-(3,4-dimethoxyphenyl)sulfonyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 50949239) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfonyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfonyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 50949239 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfonyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | COc1ccc(S(=O)(=O)N2CCN3C(=O)CNC(=O)C3C2)cc1OC |
| InChI | InChI=1S/C15H19N3O6S/c1-23-12-4-3-10(7-13(12)24-2)25(21,22)17-5-6-18-11(9-17)15(20)16-8-14(18)19/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,16,20) |
| InChIKey | MJKPWSFYBHOJDE-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |