C34H54F3N5O8Si — CID 151309737
[(E,3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-15-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-4-triethylsilyloxypentadec-5-enyl] 2,2,2-trifluoroacetate (PubChem CID 151309737) has the molecular formula C34H54F3N5O8Si and a molecular weight of 745.91 g/mol. Its IUPAC name is [(E,3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-15-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-4-triethylsilyloxypentadec-5-enyl] 2,2,2-trifluoroacetate.
| Compound Name | [(E,3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-15-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-4-triethylsilyloxypentadec-5-enyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 151309737 |
| Molecular Formula | C34H54F3N5O8Si |
| Molecular Weight | 745.91 g/mol |
| Exact Mass | 745.37 |
| IUPAC Name | [(E,3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-15-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-4-triethylsilyloxypentadec-5-enyl] 2,2,2-trifluoroacetate |
| SMILES | CC[Si](CC)(CC)O[C@H](/C=C/CCCCCCCCCNc1ccc([N+](=O)[O-])c2nonc12)[C@@H](CCOC(=O)C(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H54F3N5O8Si/c1-7-51(8-2,9-3)49-28(25(39-32(44)48-33(4,5)6)22-24-47-31(43)34(35,36)37)19-17-15-13-11-10-12-14-16-18-23-38-26-20-21-27(42(45)46)30-29(26)40-50-41-30/h17,19-21,25,28,38H,7-16,18,22-24H2,1-6H3,(H,39,44)/b19-17+/t25-,28-/m1/s1 |
| InChIKey | OEEKIQNMYCOSQG-SLVOXBHTSA-N |
| XLogP | 9.00 |
| TPSA | 167.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.91 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|