C20H16N2O4S — CID 151324771
5-[1-(1,3-benzodioxol-5-ylmethyl)indol-4-yl]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 151324771) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 5-[1-(1,3-benzodioxol-5-ylmethyl)indol-4-yl]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[1-(1,3-benzodioxol-5-ylmethyl)indol-4-yl]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 151324771 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 5-[1-(1,3-benzodioxol-5-ylmethyl)indol-4-yl]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)SC(c2cccc3c2ccn3Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C20H16N2O4S/c1-21-19(23)18(27-20(21)24)14-3-2-4-15-13(14)7-8-22(15)10-12-5-6-16-17(9-12)26-11-25-16/h2-9,18H,10-11H2,1H3 |
| InChIKey | OHEZLIWCJPHQGU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|